C15H21BFNO2 — CID 155920981
6-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 155920981) has the molecular formula C15H21BFNO2 and a molecular weight of 277.15 g/mol. Its IUPAC name is 6-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 155920981 |
| Molecular Formula | C15H21BFNO2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 6-fluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC1(C)OB(c2cc3c(cc2F)CCNC3)OC1(C)C |
| InChI | InChI=1S/C15H21BFNO2/c1-14(2)15(3,4)20-16(19-14)12-7-11-9-18-6-5-10(11)8-13(12)17/h7-8,18H,5-6,9H2,1-4H3 |
| InChIKey | FTEFUQFZLNMQHN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|