About (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride
(1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride (PubChem CID 155921130) has the molecular formula C13H20Cl2N2
and a molecular weight of 275.22 g/mol. Its IUPAC name is (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride.
Molecular Properties
| Compound Name | (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride |
| PubChem CID | 155921130 |
| Molecular Formula | C13H20Cl2N2 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(CN2C[C@@H]3CC[C@H]2CN3)cc1 |
| InChI | InChI=1S/C13H18N2.2ClH/c1-2-4-11(5-3-1)9-15-10-12-6-7-13(15)8-14-12;;/h1-5,12-14H,6-10H2;2*1H/t12-,13-;;/m0../s1 |
| InChIKey | UUJFVQTWTRPQPD-NJHZPMQHSA-N |
| XLogP | 2.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride?
The IUPAC name of (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride (CID 155921130) is (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride.
What is the SMILES notation for (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride?
The canonical SMILES for (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride is Cl.Cl.c1ccc(CN2C[C@@H]3CC[C@H]2CN3)cc1.
What is the InChIKey of (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride?
The InChIKey is UUJFVQTWTRPQPD-NJHZPMQHSA-N. The full InChI is InChI=1S/C13H18N2.2ClH/c1-2-4-11(5-3-1)9-15-10-12-6-7-13(15)8-14-12;;/h1-5,12-14H,6-10H2;2*1H/t12-,13-;;/m0../s1.
What are the key properties of (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride?
(1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride has a molecular weight of 275.22 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4S)-2-benzyl-2,5-diazabicyclo[2.2.2]octane;dihydrochloride is sourced from PubChem (CID 155921130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).