C24H29ClFN3O3 — CID 155921748
1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-[4-(fluoromethyl)imidazol-1-yl]ethanone (PubChem CID 155921748) has the molecular formula C24H29ClFN3O3 and a molecular weight of 461.97 g/mol. Its IUPAC name is 1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-[4-(fluoromethyl)imidazol-1-yl]ethanone.
| Compound Name | 1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-[4-(fluoromethyl)imidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 155921748 |
| Molecular Formula | C24H29ClFN3O3 |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-[4-(fluoromethyl)imidazol-1-yl]ethanone |
| SMILES | CC1(C)Oc2ccc(Cl)cc2C2OCC3(CCN(C(=O)Cn4cnc(CF)c4)CC3)CC21 |
| InChI | InChI=1S/C24H29ClFN3O3/c1-23(2)19-10-24(14-31-22(19)18-9-16(25)3-4-20(18)32-23)5-7-29(8-6-24)21(30)13-28-12-17(11-26)27-15-28/h3-4,9,12,15,19,22H,5-8,10-11,13-14H2,1-2H3 |
| InChIKey | ORXKWKSKILESIX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |