C24H27ClF3N3O3 — CID 155921749
1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-[4-(trifluoromethyl)imidazol-1-yl]ethanone (PubChem CID 155921749) has the molecular formula C24H27ClF3N3O3 and a molecular weight of 497.95 g/mol. Its IUPAC name is 1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-[4-(trifluoromethyl)imidazol-1-yl]ethanone.
| Compound Name | 1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-[4-(trifluoromethyl)imidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 155921749 |
| Molecular Formula | C24H27ClF3N3O3 |
| Molecular Weight | 497.95 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-[4-(trifluoromethyl)imidazol-1-yl]ethanone |
| SMILES | CC1(C)Oc2ccc(Cl)cc2C2OCC3(CCN(C(=O)Cn4cnc(C(F)(F)F)c4)CC3)CC21 |
| InChI | InChI=1S/C24H27ClF3N3O3/c1-22(2)17-10-23(13-33-21(17)16-9-15(25)3-4-18(16)34-22)5-7-31(8-6-23)20(32)12-30-11-19(29-14-30)24(26,27)28/h3-4,9,11,14,17,21H,5-8,10,12-13H2,1-2H3 |
| InChIKey | CEQOAHGSAFBBQG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.95 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |