C23H30ClN3O2 — CID 155921757
9-chloro-5,5-dimethyl-1'-[(3-methylimidazol-4-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] (PubChem CID 155921757) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 9-chloro-5,5-dimethyl-1'-[(3-methylimidazol-4-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine].
| Compound Name | 9-chloro-5,5-dimethyl-1'-[(3-methylimidazol-4-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] |
|---|---|
| PubChem CID | 155921757 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 9-chloro-5,5-dimethyl-1'-[(3-methylimidazol-4-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] |
| SMILES | Cn1cncc1CN1CCC2(CC1)COC1c3cc(Cl)ccc3OC(C)(C)C1C2 |
| InChI | InChI=1S/C23H30ClN3O2/c1-22(2)19-11-23(6-8-27(9-7-23)13-17-12-25-15-26(17)3)14-28-21(19)18-10-16(24)4-5-20(18)29-22/h4-5,10,12,15,19,21H,6-9,11,13-14H2,1-3H3 |
| InChIKey | SBBCZSYTXZBMEG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |