C25H30F9N3O2 — CID 155921904
1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 155921904) has the molecular formula C25H30F9N3O2 and a molecular weight of 575.52 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 155921904 |
| Molecular Formula | C25H30F9N3O2 |
| Molecular Weight | 575.52 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CCN(Cc3ccc(N4CCCCC4)c(C(F)(F)F)c3)C2)CC1 |
| InChI | InChI=1S/C25H30F9N3O2/c26-23(27,28)18-14-17(4-5-19(18)36-9-2-1-3-10-36)15-35-11-6-22(16-35)7-12-37(13-8-22)21(38)39-20(24(29,30)31)25(32,33)34/h4-5,14,20H,1-3,6-13,15-16H2 |
| InChIKey | AMRFGXSYZGLSCA-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.52 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|