C13H11N3O4S2 — CID 15592197
2-methyl-1,1,4-trioxo-N-(1,3-thiazol-2-yl)-3H-1lambda6,2-benzothiazine-3-carboxamide (PubChem CID 15592197) has the molecular formula C13H11N3O4S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-methyl-1,1,4-trioxo-N-(1,3-thiazol-2-yl)-3H-1lambda6,2-benzothiazine-3-carboxamide.
| Compound Name | 2-methyl-1,1,4-trioxo-N-(1,3-thiazol-2-yl)-3H-1lambda6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 15592197 |
| Molecular Formula | C13H11N3O4S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 2-methyl-1,1,4-trioxo-N-(1,3-thiazol-2-yl)-3H-1lambda6,2-benzothiazine-3-carboxamide |
| SMILES | CN1C(C(=O)Nc2nccs2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C13H11N3O4S2/c1-16-10(12(18)15-13-14-6-7-21-13)11(17)8-4-2-3-5-9(8)22(16,19)20/h2-7,10H,1H3,(H,14,15,18) |
| InChIKey | CRNPZHDSGDQQQO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|