About phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate
phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate (PubChem CID 155922377) has the molecular formula C18H17N3O2S
and a molecular weight of 339.42 g/mol. Its IUPAC name is phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate |
| PubChem CID | 155922377 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate |
| SMILES | Cc1cnc2nc([C@@H]3CCCN3C(=O)Oc3ccccc3)sc2c1 |
| InChI | InChI=1S/C18H17N3O2S/c1-12-10-15-16(19-11-12)20-17(24-15)14-8-5-9-21(14)18(22)23-13-6-3-2-4-7-13/h2-4,6-7,10-11,14H,5,8-9H2,1H3/t14-/m0/s1 |
| InChIKey | CGQXKJPTFJMTDH-AWEZNQCLSA-N |
| XLogP | 4.34 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate?
The IUPAC name of phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate (CID 155922377) is phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate.
What is the SMILES notation for phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate?
The canonical SMILES for phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate is Cc1cnc2nc([C@@H]3CCCN3C(=O)Oc3ccccc3)sc2c1.
What is the InChIKey of phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate?
The InChIKey is CGQXKJPTFJMTDH-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H17N3O2S/c1-12-10-15-16(19-11-12)20-17(24-15)14-8-5-9-21(14)18(22)23-13-6-3-2-4-7-13/h2-4,6-7,10-11,14H,5,8-9H2,1H3/t14-/m0/s1.
What are the key properties of phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate?
phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate has a molecular weight of 339.42 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl (2S)-2-(6-methyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 155922377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).