C11H17FN5O14P3 — CID 155922380
[[(2S,3S,4R,5R)-2-fluoro-3,4-dihydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 155922380) has the molecular formula C11H17FN5O14P3 and a molecular weight of 555.20 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-2-fluoro-3,4-dihydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-2-fluoro-3,4-dihydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 155922380 |
| Molecular Formula | C11H17FN5O14P3 |
| Molecular Weight | 555.20 g/mol |
| Exact Mass | 555.00 |
| IUPAC Name | [[(2S,3S,4R,5R)-2-fluoro-3,4-dihydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [H]/N=C1/N=C2C(N=CN2[C@@H]2O[C@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@@]2(C)O)C(=O)N1 |
| InChI | InChI=1S/C11H17FN5O14P3/c1-10(20)7(19)11(12,2-28-33(24,25)31-34(26,27)30-32(21,22)23)29-8(10)17-3-14-4-5(17)15-9(13)16-6(4)18/h3-4,7-8,19-20H,2H2,1H3,(H,24,25)(H,26,27)(H2,13,16,18)(H2,21,22,23)/t4?,7-,8+,10+,11+/m0/s1 |
| InChIKey | OXDLQBMGQHHDJZ-NBUBVDRLSA-N |
| XLogP | -2.36 |
| TPSA | 290.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.20 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|