C12H17FN5O14P3 — CID 155922382
[[(2S,3S,4R,5R)-5-(2-amino-6-oxo-4,5-dihydro-1H-purin-9-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 155922382) has the molecular formula C12H17FN5O14P3 and a molecular weight of 567.21 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(2-amino-6-oxo-4,5-dihydro-1H-purin-9-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-5-(2-amino-6-oxo-4,5-dihydro-1H-purin-9-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 155922382 |
| Molecular Formula | C12H17FN5O14P3 |
| Molecular Weight | 567.21 g/mol |
| Exact Mass | 567.00 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(2-amino-6-oxo-4,5-dihydro-1H-purin-9-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(O)[C@H](N2C=NC3C(=O)NC(N)=NC32)O[C@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C12H17FN5O14P3/c1-2-11(21)8(20)12(13,3-29-34(25,26)32-35(27,28)31-33(22,23)24)30-9(11)18-4-15-5-6(18)16-10(14)17-7(5)19/h1,4-6,8-9,20-21H,3H2,(H,25,26)(H,27,28)(H2,22,23,24)(H3,14,16,17,19)/t5?,6?,8-,9+,11+,12+/m0/s1 |
| InChIKey | NALGRJCFAVUQKL-MHDFXQBISA-N |
| XLogP | -3.44 |
| TPSA | 292.59 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.21 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|