C11H18F2N5O13P3 — CID 155922384
[[(2S,3S,4R,5R)-5-(2-amino-6-oxo-4,5-dihydro-1H-purin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 155922384) has the molecular formula C11H18F2N5O13P3 and a molecular weight of 559.21 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(2-amino-6-oxo-4,5-dihydro-1H-purin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-5-(2-amino-6-oxo-4,5-dihydro-1H-purin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 155922384 |
| Molecular Formula | C11H18F2N5O13P3 |
| Molecular Weight | 559.21 g/mol |
| Exact Mass | 559.01 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(2-amino-6-oxo-4,5-dihydro-1H-purin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@]1(F)[C@H](N2C=NC3C(=O)NC(N)=NC32)O[C@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C11H18F2N5O13P3/c1-10(12)7(20)11(13,2-28-33(24,25)31-34(26,27)30-32(21,22)23)29-8(10)18-3-15-4-5(18)16-9(14)17-6(4)19/h3-5,7-8,20H,2H2,1H3,(H,24,25)(H,26,27)(H2,21,22,23)(H3,14,16,17,19)/t4?,5?,7-,8+,10+,11+/m0/s1 |
| InChIKey | RTNBWTXBVQTPOZ-SJYPUEIPSA-N |
| XLogP | -2.08 |
| TPSA | 272.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.21 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|