C13H17FN4O6 — CID 155922471
(2S)-2-[[(2S,5S)-2-(acetamidomethylcarbamoyl)-3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy]-2-fluoroacetic acid (PubChem CID 155922471) has the molecular formula C13H17FN4O6 and a molecular weight of 344.30 g/mol. Its IUPAC name is (2S)-2-[[(2S,5S)-2-(acetamidomethylcarbamoyl)-3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy]-2-fluoroacetic acid.
| Compound Name | (2S)-2-[[(2S,5S)-2-(acetamidomethylcarbamoyl)-3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy]-2-fluoroacetic acid |
|---|---|
| PubChem CID | 155922471 |
| Molecular Formula | C13H17FN4O6 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (2S)-2-[[(2S,5S)-2-(acetamidomethylcarbamoyl)-3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy]-2-fluoroacetic acid |
| SMILES | CC(=O)NCNC(=O)[C@@H]1C(C)=C[C@H]2CN1C(=O)N2O[C@@H](F)C(=O)O |
| InChI | InChI=1S/C13H17FN4O6/c1-6-3-8-4-17(9(6)11(20)16-5-15-7(2)19)13(23)18(8)24-10(14)12(21)22/h3,8-10H,4-5H2,1-2H3,(H,15,19)(H,16,20)(H,21,22)/t8-,9-,10+/m0/s1 |
| InChIKey | FXRXKUVQNAIPQC-LPEHRKFASA-N |
| XLogP | -1.06 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|