C29H29F2N5O4S — CID 155922493
7-[4-(2,6-difluorophenoxy)-2-methylphenyl]-6-oxo-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 155922493) has the molecular formula C29H29F2N5O4S and a molecular weight of 581.65 g/mol. Its IUPAC name is 7-[4-(2,6-difluorophenoxy)-2-methylphenyl]-6-oxo-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | 7-[4-(2,6-difluorophenoxy)-2-methylphenyl]-6-oxo-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 155922493 |
| Molecular Formula | C29H29F2N5O4S |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | 7-[4-(2,6-difluorophenoxy)-2-methylphenyl]-6-oxo-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | C=CC(=O)N1CC[C@@H](NC(=O)C2=C3NC(=O)N(c4ccc(Oc5c(F)cccc5F)cc4C)C4CCNC(S2)C34)C1 |
| InChI | InChI=1S/C29H29F2N5O4S/c1-3-22(37)35-12-10-16(14-35)33-27(38)26-24-23-21(9-11-32-28(23)41-26)36(29(39)34-24)20-8-7-17(13-15(20)2)40-25-18(30)5-4-6-19(25)31/h3-8,13,16,21,23,28,32H,1,9-12,14H2,2H3,(H,33,38)(H,34,39)/t16-,21?,23?,28?/m1/s1 |
| InChIKey | DYPMOCCKXCFWSA-JDTIAOCQSA-N |
| XLogP | 3.76 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|