C20H28ClN5O2 — CID 15592392
2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione;hydrochloride (PubChem CID 15592392) has the molecular formula C20H28ClN5O2 and a molecular weight of 405.93 g/mol. Its IUPAC name is 2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 15592392 |
| Molecular Formula | C20H28ClN5O2 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1C2CC=CCC2C(=O)N1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H27N5O2.ClH/c26-18-16-6-1-2-7-17(16)19(27)25(18)11-4-3-10-23-12-14-24(15-13-23)20-21-8-5-9-22-20;/h1-2,5,8-9,16-17H,3-4,6-7,10-15H2;1H |
| InChIKey | GEVUBWBRPZCTGM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|