C20H38N8O3SZn — CID 155924031
ethyl (2R)-3-sulfanyl-2-[[2-[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)triazol-1-yl]acetyl]amino]propanoate;zinc (PubChem CID 155924031) has the molecular formula C20H38N8O3SZn and a molecular weight of 536.03 g/mol. Its IUPAC name is ethyl (2R)-3-sulfanyl-2-[[2-[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)triazol-1-yl]acetyl]amino]propanoate;zinc.
| Compound Name | ethyl (2R)-3-sulfanyl-2-[[2-[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)triazol-1-yl]acetyl]amino]propanoate;zinc |
|---|---|
| PubChem CID | 155924031 |
| Molecular Formula | C20H38N8O3SZn |
| Molecular Weight | 536.03 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | ethyl (2R)-3-sulfanyl-2-[[2-[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)triazol-1-yl]acetyl]amino]propanoate;zinc |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)Cn1cc(CN2CCCNCCNCCCNCC2)nn1.[Zn] |
| InChI | InChI=1S/C20H38N8O3S.Zn/c1-2-31-20(30)18(16-32)24-19(29)15-28-14-17(25-26-28)13-27-11-4-7-22-9-8-21-5-3-6-23-10-12-27;/h14,18,21-23,32H,2-13,15-16H2,1H3,(H,24,29);/t18-;/m0./s1 |
| InChIKey | SEOVGWGFYPSTBY-FERBBOLQSA-N |
| XLogP | -1.38 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.03 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|