C27H34FN5O3 — CID 155924154
N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-(4-methyl-1,3-oxazol-2-yl)-7-oxoheptyl]-1-methylpiperidine-4-carboxamide (PubChem CID 155924154) has the molecular formula C27H34FN5O3 and a molecular weight of 495.60 g/mol. Its IUPAC name is N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-(4-methyl-1,3-oxazol-2-yl)-7-oxoheptyl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-(4-methyl-1,3-oxazol-2-yl)-7-oxoheptyl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 155924154 |
| Molecular Formula | C27H34FN5O3 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-(4-methyl-1,3-oxazol-2-yl)-7-oxoheptyl]-1-methylpiperidine-4-carboxamide |
| SMILES | Cc1coc(C(=O)CCCCC[C@H](NC(=O)C2CCN(C)CC2)c2ncc(-c3ccc(F)cc3)[nH]2)n1 |
| InChI | InChI=1S/C27H34FN5O3/c1-18-17-36-27(30-18)24(34)7-5-3-4-6-22(32-26(35)20-12-14-33(2)15-13-20)25-29-16-23(31-25)19-8-10-21(28)11-9-19/h8-11,16-17,20,22H,3-7,12-15H2,1-2H3,(H,29,31)(H,32,35)/t22-/m0/s1 |
| InChIKey | UPTHKGNCOWCZQD-QFIPXVFZSA-N |
| XLogP | 4.84 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|