C25H31FN4O5 — CID 155924189
(7S)-7-amino-7-[5-[2-fluoro-3-methoxy-5-(3-methoxycyclobutyl)oxyphenyl]-1H-imidazol-2-yl]-1-(1,3-oxazol-2-yl)heptan-1-one (PubChem CID 155924189) has the molecular formula C25H31FN4O5 and a molecular weight of 486.54 g/mol. Its IUPAC name is (7S)-7-amino-7-[5-[2-fluoro-3-methoxy-5-(3-methoxycyclobutyl)oxyphenyl]-1H-imidazol-2-yl]-1-(1,3-oxazol-2-yl)heptan-1-one.
| Compound Name | (7S)-7-amino-7-[5-[2-fluoro-3-methoxy-5-(3-methoxycyclobutyl)oxyphenyl]-1H-imidazol-2-yl]-1-(1,3-oxazol-2-yl)heptan-1-one |
|---|---|
| PubChem CID | 155924189 |
| Molecular Formula | C25H31FN4O5 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (7S)-7-amino-7-[5-[2-fluoro-3-methoxy-5-(3-methoxycyclobutyl)oxyphenyl]-1H-imidazol-2-yl]-1-(1,3-oxazol-2-yl)heptan-1-one |
| SMILES | COc1cc(OC2CC(OC)C2)cc(-c2cnc([C@@H](N)CCCCCC(=O)c3ncco3)[nH]2)c1F |
| InChI | InChI=1S/C25H31FN4O5/c1-32-15-10-16(11-15)35-17-12-18(23(26)22(13-17)33-2)20-14-29-24(30-20)19(27)6-4-3-5-7-21(31)25-28-8-9-34-25/h8-9,12-16,19H,3-7,10-11,27H2,1-2H3,(H,29,30)/t15?,16?,19-/m0/s1 |
| InChIKey | VRUSKSWQLRITQD-RJYAGPCLSA-N |
| XLogP | 4.60 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|