C27H26N6O4S — CID 155924222
N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-7-(1,3-oxazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 155924222) has the molecular formula C27H26N6O4S and a molecular weight of 530.61 g/mol. Its IUPAC name is N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-7-(1,3-oxazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-7-(1,3-oxazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155924222 |
| Molecular Formula | C27H26N6O4S |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | N-[(1S)-1-[5-(2-methoxyquinolin-3-yl)-1H-imidazol-2-yl]-7-(1,3-oxazol-2-yl)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | COc1nc2ccccc2cc1-c1cnc([C@H](CCCCCC(=O)c2ncco2)NC(=O)c2cncs2)[nH]1 |
| InChI | InChI=1S/C27H26N6O4S/c1-36-26-18(13-17-7-5-6-8-19(17)33-26)21-14-30-24(31-21)20(32-25(35)23-15-28-16-38-23)9-3-2-4-10-22(34)27-29-11-12-37-27/h5-8,11-16,20H,2-4,9-10H2,1H3,(H,30,31)(H,32,35)/t20-/m0/s1 |
| InChIKey | NKOAGBYPCCDVOF-FQEVSTJZSA-N |
| XLogP | 5.38 |
| TPSA | 135.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|