C24H30FN5O3 — CID 155924247
2-(dimethylamino)-N-[(1S)-1-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-7-(5-methyl-1,2-oxazol-3-yl)-7-oxoheptyl]acetamide (PubChem CID 155924247) has the molecular formula C24H30FN5O3 and a molecular weight of 455.53 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[(1S)-1-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-7-(5-methyl-1,2-oxazol-3-yl)-7-oxoheptyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[(1S)-1-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-7-(5-methyl-1,2-oxazol-3-yl)-7-oxoheptyl]acetamide |
|---|---|
| PubChem CID | 155924247 |
| Molecular Formula | C24H30FN5O3 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 2-(dimethylamino)-N-[(1S)-1-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-7-(5-methyl-1,2-oxazol-3-yl)-7-oxoheptyl]acetamide |
| SMILES | Cc1cc(C(=O)CCCCC[C@H](NC(=O)CN(C)C)c2ncc(-c3ccccc3F)[nH]2)no1 |
| InChI | InChI=1S/C24H30FN5O3/c1-16-13-20(29-33-16)22(31)12-6-4-5-11-19(27-23(32)15-30(2)3)24-26-14-21(28-24)17-9-7-8-10-18(17)25/h7-10,13-14,19H,4-6,11-12,15H2,1-3H3,(H,26,28)(H,27,32)/t19-/m0/s1 |
| InChIKey | MIIVFFJEPMFGSH-IBGZPJMESA-N |
| XLogP | 4.06 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|