C24H36N5O13P — CID 155924336
[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(2-propan-2-yloxycarbonyloxyethyl)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid (PubChem CID 155924336) has the molecular formula C24H36N5O13P and a molecular weight of 633.55 g/mol. Its IUPAC name is [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(2-propan-2-yloxycarbonyloxyethyl)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid.
| Compound Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(2-propan-2-yloxycarbonyloxyethyl)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 155924336 |
| Molecular Formula | C24H36N5O13P |
| Molecular Weight | 633.55 g/mol |
| Exact Mass | 633.20 |
| IUPAC Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(2-propan-2-yloxycarbonyloxyethyl)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid |
| SMILES | CC(C)OC(=O)OCCP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)OCOC(=O)OC(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H32N5O9P.C4H4O4/c1-13(2)33-19(26)29-6-7-35(28,32-11-30-20(27)34-14(3)4)12-31-15(5)8-25-10-24-16-17(21)22-9-23-18(16)25;5-3(6)1-2-4(7)8/h9-10,13-15H,6-8,11-12H2,1-5H3,(H2,21,22,23);1-2H,(H,5,6)(H,7,8)/b;2-1+/t15-,35?;/m1./s1 |
| InChIKey | KUVYIMZKKANQJH-NUAPJZNESA-N |
| XLogP | 2.86 |
| TPSA | 250.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|