C17H17N5O5 — CID 155924405
(3R,6S)-6-methyl-8,10,11-trioxo-N-(pyrazin-2-ylmethyl)-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide (PubChem CID 155924405) has the molecular formula C17H17N5O5 and a molecular weight of 371.35 g/mol. Its IUPAC name is (3R,6S)-6-methyl-8,10,11-trioxo-N-(pyrazin-2-ylmethyl)-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide.
| Compound Name | (3R,6S)-6-methyl-8,10,11-trioxo-N-(pyrazin-2-ylmethyl)-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide |
|---|---|
| PubChem CID | 155924405 |
| Molecular Formula | C17H17N5O5 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (3R,6S)-6-methyl-8,10,11-trioxo-N-(pyrazin-2-ylmethyl)-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide |
| SMILES | C[C@H]1CO[C@@H]2CN3C=C(C(=O)NCc4cnccn4)C(=O)C(=O)C3C(=O)N12 |
| InChI | InChI=1S/C17H17N5O5/c1-9-8-27-12-7-21-6-11(14(23)15(24)13(21)17(26)22(9)12)16(25)20-5-10-4-18-2-3-19-10/h2-4,6,9,12-13H,5,7-8H2,1H3,(H,20,25)/t9-,12+,13?/m0/s1 |
| InChIKey | BWTMJWKCTKJNJU-XAWKZAOJSA-N |
| XLogP | -1.61 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|