C18H16Br2N4O3 — CID 155924616
N-[(E)-(2-bromophenyl)methylideneamino]-2-[2-[(2E)-2-[(2-bromophenyl)methylidene]hydrazinyl]-2-oxoethoxy]acetamide (PubChem CID 155924616) has the molecular formula C18H16Br2N4O3 and a molecular weight of 496.16 g/mol. Its IUPAC name is N-[(E)-(2-bromophenyl)methylideneamino]-2-[2-[(2E)-2-[(2-bromophenyl)methylidene]hydrazinyl]-2-oxoethoxy]acetamide.
| Compound Name | N-[(E)-(2-bromophenyl)methylideneamino]-2-[2-[(2E)-2-[(2-bromophenyl)methylidene]hydrazinyl]-2-oxoethoxy]acetamide |
|---|---|
| PubChem CID | 155924616 |
| Molecular Formula | C18H16Br2N4O3 |
| Molecular Weight | 496.16 g/mol |
| Exact Mass | 493.96 |
| IUPAC Name | N-[(E)-(2-bromophenyl)methylideneamino]-2-[2-[(2E)-2-[(2-bromophenyl)methylidene]hydrazinyl]-2-oxoethoxy]acetamide |
| SMILES | O=C(COCC(=O)N/N=C/c1ccccc1Br)N/N=C/c1ccccc1Br |
| InChI | InChI=1S/C18H16Br2N4O3/c19-15-7-3-1-5-13(15)9-21-23-17(25)11-27-12-18(26)24-22-10-14-6-2-4-8-16(14)20/h1-10H,11-12H2,(H,23,25)(H,24,26)/b21-9+,22-10+ |
| InChIKey | UGFXMVZBKQCRIP-VGENTYGXSA-N |
| XLogP | 2.83 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|