C30H33N3O6S — CID 155924777
N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-oxochromene-6-carboxamide (PubChem CID 155924777) has the molecular formula C30H33N3O6S and a molecular weight of 563.68 g/mol. Its IUPAC name is N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-oxochromene-6-carboxamide.
| Compound Name | N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-oxochromene-6-carboxamide |
|---|---|
| PubChem CID | 155924777 |
| Molecular Formula | C30H33N3O6S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-oxochromene-6-carboxamide |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)c1ccc2oc(=O)ccc2c1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C30H33N3O6S/c1-20(2)18-33(40(37,38)25-12-10-24(31)11-13-25)19-27(34)26(16-21-6-4-3-5-7-21)32-30(36)23-8-14-28-22(17-23)9-15-29(35)39-28/h3-15,17,20,26-27,34H,16,18-19,31H2,1-2H3,(H,32,36)/t26-,27+/m0/s1 |
| InChIKey | DLVWRVNLMLSWAC-RRPNLBNLSA-N |
| XLogP | 3.42 |
| TPSA | 142.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|