C27H36N8O2Zn — CID 155924879
2-ethyl-6-[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)triazol-1-yl]benzo[de]isoquinoline-1,3-dione;zinc (PubChem CID 155924879) has the molecular formula C27H36N8O2Zn and a molecular weight of 570.03 g/mol. Its IUPAC name is 2-ethyl-6-[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)triazol-1-yl]benzo[de]isoquinoline-1,3-dione;zinc.
| Compound Name | 2-ethyl-6-[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)triazol-1-yl]benzo[de]isoquinoline-1,3-dione;zinc |
|---|---|
| PubChem CID | 155924879 |
| Molecular Formula | C27H36N8O2Zn |
| Molecular Weight | 570.03 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 2-ethyl-6-[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)triazol-1-yl]benzo[de]isoquinoline-1,3-dione;zinc |
| SMILES | CCN1C(=O)c2cccc3c(-n4cc(CN5CCCNCCNCCCNCC5)nn4)ccc(c23)C1=O.[Zn] |
| InChI | InChI=1S/C27H36N8O2.Zn/c1-2-34-26(36)22-7-3-6-21-24(9-8-23(25(21)22)27(34)37)35-19-20(31-32-35)18-33-16-5-12-29-14-13-28-10-4-11-30-15-17-33;/h3,6-9,19,28-30H,2,4-5,10-18H2,1H3; |
| InChIKey | VQYYCRPVIASCBX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.03 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|