C26H32FN5O2S — CID 155925141
N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-oxo-7-(1,3-thiazol-2-yl)heptyl]-1-methylpiperidine-4-carboxamide (PubChem CID 155925141) has the molecular formula C26H32FN5O2S and a molecular weight of 497.64 g/mol. Its IUPAC name is N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-oxo-7-(1,3-thiazol-2-yl)heptyl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-oxo-7-(1,3-thiazol-2-yl)heptyl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 155925141 |
| Molecular Formula | C26H32FN5O2S |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-oxo-7-(1,3-thiazol-2-yl)heptyl]-1-methylpiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)N[C@@H](CCCCCC(=O)c2nccs2)c2ncc(-c3ccc(F)cc3)[nH]2)CC1 |
| InChI | InChI=1S/C26H32FN5O2S/c1-32-14-11-19(12-15-32)25(34)31-21(5-3-2-4-6-23(33)26-28-13-16-35-26)24-29-17-22(30-24)18-7-9-20(27)10-8-18/h7-10,13,16-17,19,21H,2-6,11-12,14-15H2,1H3,(H,29,30)(H,31,34)/t21-/m0/s1 |
| InChIKey | OEVNYXUGKVJBIX-NRFANRHFSA-N |
| XLogP | 5.00 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|