C11H9N5S — CID 155925239
4-(1H-pyrazol-5-yl)-N-pyridin-2-yl-1,3-thiazol-2-amine (PubChem CID 155925239) has the molecular formula C11H9N5S and a molecular weight of 243.30 g/mol. Its IUPAC name is 4-(1H-pyrazol-5-yl)-N-pyridin-2-yl-1,3-thiazol-2-amine.
| Compound Name | 4-(1H-pyrazol-5-yl)-N-pyridin-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155925239 |
| Molecular Formula | C11H9N5S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 4-(1H-pyrazol-5-yl)-N-pyridin-2-yl-1,3-thiazol-2-amine |
| SMILES | c1ccc(Nc2nc(-c3ccn[nH]3)cs2)nc1 |
| InChI | InChI=1S/C11H9N5S/c1-2-5-12-10(3-1)15-11-14-9(7-17-11)8-4-6-13-16-8/h1-7H,(H,13,16)(H,12,14,15) |
| InChIKey | LVVJIXJPYCLBJL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |