C22H23N5O5 — CID 155925553
(3R,6S)-N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-6-methyl-8,10,11-trioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide (PubChem CID 155925553) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is (3R,6S)-N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-6-methyl-8,10,11-trioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide.
| Compound Name | (3R,6S)-N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-6-methyl-8,10,11-trioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide |
|---|---|
| PubChem CID | 155925553 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (3R,6S)-N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-6-methyl-8,10,11-trioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]tridec-12-ene-12-carboxamide |
| SMILES | Cc1nc2cc(CNC(=O)C3=CN4C[C@H]5OC[C@H](C)N5C(=O)C4C(=O)C3=O)ccc2n1C |
| InChI | InChI=1S/C22H23N5O5/c1-11-10-32-17-9-26-8-14(19(28)20(29)18(26)22(31)27(11)17)21(30)23-7-13-4-5-16-15(6-13)24-12(2)25(16)3/h4-6,8,11,17-18H,7,9-10H2,1-3H3,(H,23,30)/t11-,17+,18?/m0/s1 |
| InChIKey | RBKUTXKDLHJTFU-FKDGXDBKSA-N |
| XLogP | -0.21 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|