C24H25N5O — CID 155925556
N-(5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-4-pentylbenzamide (PubChem CID 155925556) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is N-(5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-4-pentylbenzamide.
| Compound Name | N-(5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-4-pentylbenzamide |
|---|---|
| PubChem CID | 155925556 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-(5-methyl-7-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)Nc2nc3nc(C)cc(-c4ccccc4)n3n2)cc1 |
| InChI | InChI=1S/C24H25N5O/c1-3-4-6-9-18-12-14-20(15-13-18)22(30)26-23-27-24-25-17(2)16-21(29(24)28-23)19-10-7-5-8-11-19/h5,7-8,10-16H,3-4,6,9H2,1-2H3,(H,26,28,30) |
| InChIKey | QOBGZRUJLBNLNT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|