About (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride
(1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride (PubChem CID 155926129) has the molecular formula C16H18ClNS
and a molecular weight of 291.85 g/mol. Its IUPAC name is (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride.
Molecular Properties
| Compound Name | (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride |
| PubChem CID | 155926129 |
| Molecular Formula | C16H18ClNS |
| Molecular Weight | 291.85 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride |
| SMILES | CCSC(=[NH2+])C(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C16H17NS.ClH/c1-2-18-16(17)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;/h3-12,15,17H,2H2,1H3;1H |
| InChIKey | OMTOAFQUXPRGHX-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 25.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.85 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride?
The IUPAC name of (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride (CID 155926129) is (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride.
What is the SMILES notation for (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride?
The canonical SMILES for (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride is CCSC(=[NH2+])C(c1ccccc1)c1ccccc1.[Cl-].
What is the InChIKey of (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride?
The InChIKey is OMTOAFQUXPRGHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NS.ClH/c1-2-18-16(17)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;/h3-12,15,17H,2H2,1H3;1H.
What are the key properties of (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride?
(1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride has a molecular weight of 291.85 g/mol, XLogP of -0.27, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylsulfanyl-2,2-diphenylethylidene)azanium chloride is sourced from PubChem (CID 155926129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).