C23H19NO3 — CID 155926240
1-(3,3-diphenylpropyl)-3,1-benzoxazine-2,4-dione (PubChem CID 155926240) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3,1-benzoxazine-2,4-dione.
| Compound Name | 1-(3,3-diphenylpropyl)-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 155926240 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3,1-benzoxazine-2,4-dione |
| SMILES | O=c1oc(=O)n(CCC(c2ccccc2)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C23H19NO3/c25-22-20-13-7-8-14-21(20)24(23(26)27-22)16-15-19(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14,19H,15-16H2 |
| InChIKey | CTZDUEYGPXHGCI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |