About 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one
7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one (PubChem CID 155926794) has the molecular formula C22H26N2O3
and a molecular weight of 366.46 g/mol. Its IUPAC name is 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one |
| PubChem CID | 155926794 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one |
| SMILES | Cc1cc(-c2ccc3c(c2)N(C[C@H]2CCCCO2)C(=O)CC3)cn(C)c1=O |
| InChI | InChI=1S/C22H26N2O3/c1-15-11-18(13-23(2)22(15)26)17-7-6-16-8-9-21(25)24(20(16)12-17)14-19-5-3-4-10-27-19/h6-7,11-13,19H,3-5,8-10,14H2,1-2H3/t19-/m1/s1 |
| InChIKey | PAIPFCICCDDSMM-LJQANCHMSA-N |
| XLogP | 3.21 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one?
The IUPAC name of 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one (CID 155926794) is 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one?
The canonical SMILES for 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one is Cc1cc(-c2ccc3c(c2)N(C[C@H]2CCCCO2)C(=O)CC3)cn(C)c1=O.
What is the InChIKey of 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one?
The InChIKey is PAIPFCICCDDSMM-LJQANCHMSA-N. The full InChI is InChI=1S/C22H26N2O3/c1-15-11-18(13-23(2)22(15)26)17-7-6-16-8-9-21(25)24(20(16)12-17)14-19-5-3-4-10-27-19/h6-7,11-13,19H,3-5,8-10,14H2,1-2H3/t19-/m1/s1.
What are the key properties of 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one?
7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one has a molecular weight of 366.46 g/mol, XLogP of 3.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1,5-dimethyl-6-oxo-3-pyridinyl)-1-[[(2R)-oxan-2-yl]methyl]-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 155926794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).