C13H20O10 — CID 155926845
3,6-dimethyl-1,4-dioxane-2,5-dione;1,4-dioxane-2,5-dione;2-methoxyethanol (PubChem CID 155926845) has the molecular formula C13H20O10 and a molecular weight of 336.29 g/mol. Its IUPAC name is 3,6-dimethyl-1,4-dioxane-2,5-dione;1,4-dioxane-2,5-dione;2-methoxyethanol.
| Compound Name | 3,6-dimethyl-1,4-dioxane-2,5-dione;1,4-dioxane-2,5-dione;2-methoxyethanol |
|---|---|
| PubChem CID | 155926845 |
| Molecular Formula | C13H20O10 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3,6-dimethyl-1,4-dioxane-2,5-dione;1,4-dioxane-2,5-dione;2-methoxyethanol |
| SMILES | CC1OC(=O)C(C)OC1=O.COCCO.O=C1COC(=O)CO1 |
| InChI | InChI=1S/C6H8O4.C4H4O4.C3H8O2/c1-3-5(7)10-4(2)6(8)9-3;5-3-1-7-4(6)2-8-3;1-5-3-2-4/h3-4H,1-2H3;1-2H2;4H,2-3H2,1H3 |
| InChIKey | VNEFDAQIOSJTCT-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|