C30H49NO — CID 155926870
[(1R,2S,5S,8R,14R,15R,21R)-1,2,5,8,15,20,20-heptamethyl-19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricosa-10,12-dien-8-yl]methanol (PubChem CID 155926870) has the molecular formula C30H49NO and a molecular weight of 439.73 g/mol. Its IUPAC name is [(1R,2S,5S,8R,14R,15R,21R)-1,2,5,8,15,20,20-heptamethyl-19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricosa-10,12-dien-8-yl]methanol.
| Compound Name | [(1R,2S,5S,8R,14R,15R,21R)-1,2,5,8,15,20,20-heptamethyl-19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricosa-10,12-dien-8-yl]methanol |
|---|---|
| PubChem CID | 155926870 |
| Molecular Formula | C30H49NO |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 439.38 |
| IUPAC Name | [(1R,2S,5S,8R,14R,15R,21R)-1,2,5,8,15,20,20-heptamethyl-19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricosa-10,12-dien-8-yl]methanol |
| SMILES | CC1(C)NCCC[C@]2(C)[C@H]3C=CC4=C5C[C@](C)(CO)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C30H49NO/c1-25(2)23-11-13-30(7)24(28(23,5)12-8-18-31-25)10-9-21-22-19-26(3,20-32)14-15-27(22,4)16-17-29(21,30)6/h9-10,23-24,31-32H,8,11-20H2,1-7H3/t23-,24+,26+,27+,28-,29+,30+/m0/s1 |
| InChIKey | RYFGQOJEHHRXDJ-KBWXFIBOSA-N |
| XLogP | 7.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |