C31H28ClNO8 — CID 155926953
4-chloro-7-[3-(1,3-dioxolan-2-ylmethyl)-1-hydroxy-9-oxoxanthen-2-yl]-8-hydroxy-5-methoxy-2-methyl-3-propylisoquinolin-1-one (PubChem CID 155926953) has the molecular formula C31H28ClNO8 and a molecular weight of 578.02 g/mol. Its IUPAC name is 4-chloro-7-[3-(1,3-dioxolan-2-ylmethyl)-1-hydroxy-9-oxoxanthen-2-yl]-8-hydroxy-5-methoxy-2-methyl-3-propylisoquinolin-1-one.
| Compound Name | 4-chloro-7-[3-(1,3-dioxolan-2-ylmethyl)-1-hydroxy-9-oxoxanthen-2-yl]-8-hydroxy-5-methoxy-2-methyl-3-propylisoquinolin-1-one |
|---|---|
| PubChem CID | 155926953 |
| Molecular Formula | C31H28ClNO8 |
| Molecular Weight | 578.02 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | 4-chloro-7-[3-(1,3-dioxolan-2-ylmethyl)-1-hydroxy-9-oxoxanthen-2-yl]-8-hydroxy-5-methoxy-2-methyl-3-propylisoquinolin-1-one |
| SMILES | CCCc1c(Cl)c2c(OC)cc(-c3c(CC4OCCO4)cc4oc5ccccc5c(=O)c4c3O)c(O)c2c(=O)n1C |
| InChI | InChI=1S/C31H28ClNO8/c1-4-7-18-27(32)24-20(38-3)14-17(29(35)26(24)31(37)33(18)2)23-15(13-22-39-10-11-40-22)12-21-25(30(23)36)28(34)16-8-5-6-9-19(16)41-21/h5-6,8-9,12,14,22,35-36H,4,7,10-11,13H2,1-3H3 |
| InChIKey | JBANDUZBWIWHMF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.02 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|