C25H18F4N6OS — CID 155927052
N-[2-[[4-[6-(3-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 155927052) has the molecular formula C25H18F4N6OS and a molecular weight of 526.52 g/mol. Its IUPAC name is N-[2-[[4-[6-(3-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[4-[6-(3-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 155927052 |
| Molecular Formula | C25H18F4N6OS |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | N-[2-[[4-[6-(3-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCNc1nccc(-c2c(-c3cccc(F)c3)nc3sccn23)n1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H18F4N6OS/c26-18-3-1-2-16(14-18)20-21(35-12-13-37-24(35)34-20)19-8-9-31-23(33-19)32-11-10-30-22(36)15-4-6-17(7-5-15)25(27,28)29/h1-9,12-14H,10-11H2,(H,30,36)(H,31,32,33) |
| InChIKey | QTSHUXOHPYIBLP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|