About [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate
[3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate (PubChem CID 155927371) has the molecular formula C16H19NO8
and a molecular weight of 353.33 g/mol. Its IUPAC name is [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate.
Molecular Properties
| Compound Name | [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate |
| PubChem CID | 155927371 |
| Molecular Formula | C16H19NO8 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate |
| SMILES | COc1ccc2c(c1OC)CN(C(=O)C(C)(O)COC(C)=O)C(=O)O2 |
| InChI | InChI=1S/C16H19NO8/c1-9(18)24-8-16(2,21)14(19)17-7-10-11(25-15(17)20)5-6-12(22-3)13(10)23-4/h5-6,21H,7-8H2,1-4H3 |
| InChIKey | NRCXPUPSNMMESY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate?
The IUPAC name of [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate (CID 155927371) is [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate.
What is the SMILES notation for [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate?
The canonical SMILES for [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate is COc1ccc2c(c1OC)CN(C(=O)C(C)(O)COC(C)=O)C(=O)O2.
What is the InChIKey of [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate?
The InChIKey is NRCXPUPSNMMESY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO8/c1-9(18)24-8-16(2,21)14(19)17-7-10-11(25-15(17)20)5-6-12(22-3)13(10)23-4/h5-6,21H,7-8H2,1-4H3.
What are the key properties of [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate?
[3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate has a molecular weight of 353.33 g/mol, XLogP of 0.86, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5,6-dimethoxy-2-oxo-4H-1,3-benzoxazin-3-yl)-2-hydroxy-2-methyl-3-oxopropyl] acetate is sourced from PubChem (CID 155927371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).