C33H38O7 — CID 155927410
[2-[[(1S,2R,5R,6R,7S,8R,10R)-1,5-dimethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl]oxy]-2-oxoethyl] benzoate (PubChem CID 155927410) has the molecular formula C33H38O7 and a molecular weight of 546.66 g/mol. Its IUPAC name is [2-[[(1S,2R,5R,6R,7S,8R,10R)-1,5-dimethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl]oxy]-2-oxoethyl] benzoate.
| Compound Name | [2-[[(1S,2R,5R,6R,7S,8R,10R)-1,5-dimethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl]oxy]-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 155927410 |
| Molecular Formula | C33H38O7 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | [2-[[(1S,2R,5R,6R,7S,8R,10R)-1,5-dimethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl]oxy]-2-oxoethyl] benzoate |
| SMILES | CC(C)[C@@]12C[C@@H](OC(=O)COC(=O)c3ccccc3)[C@@](C)(O1)[C@@H]1CC[C@@H](C)[C@H]1[C@@H]2OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C33H38O7/c1-21(2)33-19-26(38-28(35)20-37-31(36)24-13-9-6-10-14-24)32(4,40-33)25-17-15-22(3)29(25)30(33)39-27(34)18-16-23-11-7-5-8-12-23/h5-14,16,18,21-22,25-26,29-30H,15,17,19-20H2,1-4H3/b18-16+/t22-,25-,26-,29-,30+,32+,33-/m1/s1 |
| InChIKey | OPOPGKABCJCILM-CEZQUNQDSA-N |
| XLogP | 5.63 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|