C10H9N5S2 — CID 155927418
4-hydrazinyl-2-methylsulfanyl-6-thiophen-2-ylpyrimidine-5-carbonitrile (PubChem CID 155927418) has the molecular formula C10H9N5S2 and a molecular weight of 263.35 g/mol. Its IUPAC name is 4-hydrazinyl-2-methylsulfanyl-6-thiophen-2-ylpyrimidine-5-carbonitrile.
| Compound Name | 4-hydrazinyl-2-methylsulfanyl-6-thiophen-2-ylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 155927418 |
| Molecular Formula | C10H9N5S2 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 4-hydrazinyl-2-methylsulfanyl-6-thiophen-2-ylpyrimidine-5-carbonitrile |
| SMILES | CSc1nc(NN)c(C#N)c(-c2cccs2)n1 |
| InChI | InChI=1S/C10H9N5S2/c1-16-10-13-8(7-3-2-4-17-7)6(5-11)9(14-10)15-12/h2-4H,12H2,1H3,(H,13,14,15) |
| InChIKey | WGIVMGPFWYQUNN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|