C27H22N4O5 — CID 155927580
[1-[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]triazol-4-yl]methyl 9-oxo-10H-acridine-4-carboxylate (PubChem CID 155927580) has the molecular formula C27H22N4O5 and a molecular weight of 482.50 g/mol. Its IUPAC name is [1-[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]triazol-4-yl]methyl 9-oxo-10H-acridine-4-carboxylate.
| Compound Name | [1-[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]triazol-4-yl]methyl 9-oxo-10H-acridine-4-carboxylate |
|---|---|
| PubChem CID | 155927580 |
| Molecular Formula | C27H22N4O5 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | [1-[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]triazol-4-yl]methyl 9-oxo-10H-acridine-4-carboxylate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)n1cc(COC(=O)c2cccc3c(=O)c4ccccc4[nH]c23)nn1 |
| InChI | InChI=1S/C27H22N4O5/c1-35-27(34)23(14-17-8-3-2-4-9-17)31-15-18(29-30-31)16-36-26(33)21-12-7-11-20-24(21)28-22-13-6-5-10-19(22)25(20)32/h2-13,15,23H,14,16H2,1H3,(H,28,32)/t23-/m1/s1 |
| InChIKey | XCTYVBINWSVDJK-HSZRJFAPSA-N |
| XLogP | 3.59 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|