About (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate
(3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate (PubChem CID 155927642) has the molecular formula C19H15F2NO2
and a molecular weight of 327.33 g/mol. Its IUPAC name is (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate.
Molecular Properties
| Compound Name | (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate |
| PubChem CID | 155927642 |
| Molecular Formula | C19H15F2NO2 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate |
| SMILES | O=C(OC(CC(F)F)c1ccc2ccccc2c1)c1ccccn1 |
| InChI | InChI=1S/C19H15F2NO2/c20-18(21)12-17(24-19(23)16-7-3-4-10-22-16)15-9-8-13-5-1-2-6-14(13)11-15/h1-11,17-18H,12H2 |
| InChIKey | BVWMCGMWOZTEDV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate?
The IUPAC name of (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate (CID 155927642) is (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate.
What is the SMILES notation for (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate?
The canonical SMILES for (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate is O=C(OC(CC(F)F)c1ccc2ccccc2c1)c1ccccn1.
What is the InChIKey of (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate?
The InChIKey is BVWMCGMWOZTEDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F2NO2/c20-18(21)12-17(24-19(23)16-7-3-4-10-22-16)15-9-8-13-5-1-2-6-14(13)11-15/h1-11,17-18H,12H2.
What are the key properties of (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate?
(3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate has a molecular weight of 327.33 g/mol, XLogP of 4.79, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluoro-1-naphthalen-2-ylpropyl) pyridine-2-carboxylate is sourced from PubChem (CID 155927642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).