C28H34N2OS — CID 155927872
(1S,2R,13R,14S,18S)-2,18-dimethyl-7-(2-phenylethylamino)-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one (PubChem CID 155927872) has the molecular formula C28H34N2OS and a molecular weight of 446.66 g/mol. Its IUPAC name is (1S,2R,13R,14S,18S)-2,18-dimethyl-7-(2-phenylethylamino)-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one.
| Compound Name | (1S,2R,13R,14S,18S)-2,18-dimethyl-7-(2-phenylethylamino)-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one |
|---|---|
| PubChem CID | 155927872 |
| Molecular Formula | C28H34N2OS |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (1S,2R,13R,14S,18S)-2,18-dimethyl-7-(2-phenylethylamino)-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one |
| SMILES | C[C@]12CCc3sc(NCCc4ccccc4)nc3C1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C28H34N2OS/c1-27-16-13-23-25(30-26(32-23)29-17-14-18-6-4-3-5-7-18)22(27)9-8-19-20-10-11-24(31)28(20,2)15-12-21(19)27/h3-7,9,19-21H,8,10-17H2,1-2H3,(H,29,30)/t19-,20-,21-,27+,28-/m0/s1 |
| InChIKey | JZARNTKAWBAEKJ-SVHPMLGESA-N |
| XLogP | 6.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |