C21H22BrN3O — CID 155927940
6-bromo-N-[(E)-(4-butoxyphenyl)methylideneamino]-2-methylquinolin-4-amine (PubChem CID 155927940) has the molecular formula C21H22BrN3O and a molecular weight of 412.33 g/mol. Its IUPAC name is 6-bromo-N-[(E)-(4-butoxyphenyl)methylideneamino]-2-methylquinolin-4-amine.
| Compound Name | 6-bromo-N-[(E)-(4-butoxyphenyl)methylideneamino]-2-methylquinolin-4-amine |
|---|---|
| PubChem CID | 155927940 |
| Molecular Formula | C21H22BrN3O |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 6-bromo-N-[(E)-(4-butoxyphenyl)methylideneamino]-2-methylquinolin-4-amine |
| SMILES | CCCCOc1ccc(/C=N/Nc2cc(C)nc3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C21H22BrN3O/c1-3-4-11-26-18-8-5-16(6-9-18)14-23-25-21-12-15(2)24-20-10-7-17(22)13-19(20)21/h5-10,12-14H,3-4,11H2,1-2H3,(H,24,25)/b23-14+ |
| InChIKey | YJLUAODLALNCKB-OEAKJJBVSA-N |
| XLogP | 5.93 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|