C26H30FNOS — CID 155927960
(1S,2R,13R,14S,17S,18S)-7-(3-fluorophenyl)-2,18-dimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-ol (PubChem CID 155927960) has the molecular formula C26H30FNOS and a molecular weight of 423.60 g/mol. Its IUPAC name is (1S,2R,13R,14S,17S,18S)-7-(3-fluorophenyl)-2,18-dimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-ol.
| Compound Name | (1S,2R,13R,14S,17S,18S)-7-(3-fluorophenyl)-2,18-dimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-ol |
|---|---|
| PubChem CID | 155927960 |
| Molecular Formula | C26H30FNOS |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (1S,2R,13R,14S,17S,18S)-7-(3-fluorophenyl)-2,18-dimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4c5nc(-c6cccc(F)c6)sc5CC[C@@]43C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C26H30FNOS/c1-25-13-11-21-23(28-24(30-21)15-4-3-5-16(27)14-15)20(25)7-6-17-18-8-9-22(29)26(18,2)12-10-19(17)25/h3-5,7,14,17-19,22,29H,6,8-13H2,1-2H3/t17-,18-,19-,22-,25+,26-/m0/s1 |
| InChIKey | CAZQZKUEZNEZPQ-ZSGDZNMQSA-N |
| XLogP | 6.49 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |