C16H16O6 — CID 155928187
6-(3,4-dimethoxy-6-oxocyclohexa-2,4-dien-1-ylidene)-3,4-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 155928187) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is 6-(3,4-dimethoxy-6-oxocyclohexa-2,4-dien-1-ylidene)-3,4-dimethoxycyclohexa-2,4-dien-1-one.
| Compound Name | 6-(3,4-dimethoxy-6-oxocyclohexa-2,4-dien-1-ylidene)-3,4-dimethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 155928187 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 6-(3,4-dimethoxy-6-oxocyclohexa-2,4-dien-1-ylidene)-3,4-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1=CC(=O)C(=C2C=C(OC)C(OC)=CC2=O)C=C1OC |
| InChI | InChI=1S/C16H16O6/c1-19-13-5-9(11(17)7-15(13)21-3)10-6-14(20-2)16(22-4)8-12(10)18/h5-8H,1-4H3 |
| InChIKey | IVNDLVYBJZCYGE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|