About 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde
5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde (PubChem CID 155928252) has the molecular formula C23H18N2O3
and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde.
Molecular Properties
| Compound Name | 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde |
| PubChem CID | 155928252 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde |
| SMILES | COc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc(C=O)c1O |
| InChI | InChI=1S/C23H18N2O3/c1-28-19-13-17(12-18(14-26)22(19)27)23-24-20(15-8-4-2-5-9-15)21(25-23)16-10-6-3-7-11-16/h2-14,27H,1H3,(H,24,25) |
| InChIKey | IJXHEDIRCZGVOW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde?
The IUPAC name of 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde (CID 155928252) is 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde.
What is the SMILES notation for 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde?
The canonical SMILES for 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde is COc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc(C=O)c1O.
What is the InChIKey of 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde?
The InChIKey is IJXHEDIRCZGVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O3/c1-28-19-13-17(12-18(14-26)22(19)27)23-24-20(15-8-4-2-5-9-15)21(25-23)16-10-6-3-7-11-16/h2-14,27H,1H3,(H,24,25).
What are the key properties of 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde?
5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde has a molecular weight of 370.41 g/mol, XLogP of 4.94, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-diphenyl-1H-imidazol-2-yl)-2-hydroxy-3-methoxybenzaldehyde is sourced from PubChem (CID 155928252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).