About 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde
2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde (PubChem CID 155928278) has the molecular formula C29H22N2O3
and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde.
Molecular Properties
| Compound Name | 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde |
| PubChem CID | 155928278 |
| Molecular Formula | C29H22N2O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde |
| SMILES | COc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)n2-c2ccccc2)cc(C=O)c1O |
| InChI | InChI=1S/C29H22N2O3/c1-34-25-18-22(17-23(19-32)28(25)33)29-30-26(20-11-5-2-6-12-20)27(21-13-7-3-8-14-21)31(29)24-15-9-4-10-16-24/h2-19,33H,1H3 |
| InChIKey | ROPABCRKQCJMHY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde?
The IUPAC name of 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde (CID 155928278) is 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde.
What is the SMILES notation for 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde?
The canonical SMILES for 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde is COc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)n2-c2ccccc2)cc(C=O)c1O.
What is the InChIKey of 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde?
The InChIKey is ROPABCRKQCJMHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22N2O3/c1-34-25-18-22(17-23(19-32)28(25)33)29-30-26(20-11-5-2-6-12-20)27(21-13-7-3-8-14-21)31(29)24-15-9-4-10-16-24/h2-19,33H,1H3.
What are the key properties of 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde?
2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde has a molecular weight of 446.51 g/mol, XLogP of 6.40, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-methoxy-5-(1,4,5-triphenylimidazol-2-yl)benzaldehyde is sourced from PubChem (CID 155928278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).