About 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde
5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde (PubChem CID 155928295) has the molecular formula C31H26N2O4
and a molecular weight of 490.56 g/mol. Its IUPAC name is 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde.
Molecular Properties
| Compound Name | 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde |
| PubChem CID | 155928295 |
| Molecular Formula | C31H26N2O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde |
| SMILES | CCOc1ccc(-n2c(-c3cc(C=O)c(O)c(OC)c3)nc(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26N2O4/c1-3-37-26-16-14-25(15-17-26)33-29(22-12-8-5-9-13-22)28(21-10-6-4-7-11-21)32-31(33)23-18-24(20-34)30(35)27(19-23)36-2/h4-20,35H,3H2,1-2H3 |
| InChIKey | HYOMTNZWOGNZMW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde?
The IUPAC name of 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde (CID 155928295) is 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde.
What is the SMILES notation for 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde?
The canonical SMILES for 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde is CCOc1ccc(-n2c(-c3cc(C=O)c(O)c(OC)c3)nc(-c3ccccc3)c2-c2ccccc2)cc1.
What is the InChIKey of 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde?
The InChIKey is HYOMTNZWOGNZMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H26N2O4/c1-3-37-26-16-14-25(15-17-26)33-29(22-12-8-5-9-13-22)28(21-10-6-4-7-11-21)32-31(33)23-18-24(20-34)30(35)27(19-23)36-2/h4-20,35H,3H2,1-2H3.
What are the key properties of 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde?
5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde has a molecular weight of 490.56 g/mol, XLogP of 6.80, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(4-ethoxyphenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde is sourced from PubChem (CID 155928295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).