C32H22ClN3O4S — CID 155928309
(5Z)-5-[[5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 155928309) has the molecular formula C32H22ClN3O4S and a molecular weight of 580.07 g/mol. Its IUPAC name is (5Z)-5-[[5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 155928309 |
| Molecular Formula | C32H22ClN3O4S |
| Molecular Weight | 580.07 g/mol |
| Exact Mass | 579.10 |
| IUPAC Name | (5Z)-5-[[5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)n2-c2ccc(Cl)cc2)cc(/C=C2\SC(=O)NC2=O)c1O |
| InChI | InChI=1S/C32H22ClN3O4S/c1-40-25-17-22(16-21(29(25)37)18-26-31(38)35-32(39)41-26)30-34-27(19-8-4-2-5-9-19)28(20-10-6-3-7-11-20)36(30)24-14-12-23(33)13-15-24/h2-18,37H,1H3,(H,35,38,39)/b26-18- |
| InChIKey | HWMBIEARFGWHFO-ITYLOYPMSA-N |
| XLogP | 7.56 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.07 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|