C10H15N3O2 — CID 155928497
2-(4-hydroxypyrazol-1-yl)-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 155928497) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(4-hydroxypyrazol-1-yl)-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 2-(4-hydroxypyrazol-1-yl)-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 155928497 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-(4-hydroxypyrazol-1-yl)-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | CC(C(=O)N1CCCC1)n1cc(O)cn1 |
| InChI | InChI=1S/C10H15N3O2/c1-8(13-7-9(14)6-11-13)10(15)12-4-2-3-5-12/h6-8,14H,2-5H2,1H3 |
| InChIKey | ANOFOIGXDXPTKB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |