C24H14N2O2 — CID 155929142
27,28-dioxa-12,25-diazaheptacyclo[21.3.1.110,14.05,26.06,11.013,18.019,24]octacosa-1,3,5(26),6(11),7,9,13(18),14,16,19(24),20,22-dodecaene (PubChem CID 155929142) has the molecular formula C24H14N2O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 27,28-dioxa-12,25-diazaheptacyclo[21.3.1.110,14.05,26.06,11.013,18.019,24]octacosa-1,3,5(26),6(11),7,9,13(18),14,16,19(24),20,22-dodecaene.
| Compound Name | 27,28-dioxa-12,25-diazaheptacyclo[21.3.1.110,14.05,26.06,11.013,18.019,24]octacosa-1,3,5(26),6(11),7,9,13(18),14,16,19(24),20,22-dodecaene |
|---|---|
| PubChem CID | 155929142 |
| Molecular Formula | C24H14N2O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 27,28-dioxa-12,25-diazaheptacyclo[21.3.1.110,14.05,26.06,11.013,18.019,24]octacosa-1,3,5(26),6(11),7,9,13(18),14,16,19(24),20,22-dodecaene |
| SMILES | c1cc2oc3cccc4c5cccc6oc7cccc(c(c1)c2[nH]c34)c7[nH]c65 |
| InChI | InChI=1S/C24H14N2O2/c1-5-13-14-6-2-11-19-22(14)26-24-16(8-4-12-20(24)28-19)15-7-3-10-18-23(15)25-21(13)17(9-1)27-18/h1-12,25-26H |
| InChIKey | OBKMDHAXBUPBAV-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|